C16H21FN4O — CID 120503327
3-amino-N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-methylbutanamide (PubChem CID 120503327) has the molecular formula C16H21FN4O and a molecular weight of 304.37 g/mol. Its IUPAC name is 3-amino-N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-methylbutanamide.
| Compound Name | 3-amino-N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 120503327 |
| Molecular Formula | C16H21FN4O |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 3-amino-N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-methylbutanamide |
| SMILES | Cc1nccn1-c1ccc(CNC(=O)C(C)C(C)N)cc1F |
| InChI | InChI=1S/C16H21FN4O/c1-10(11(2)18)16(22)20-9-13-4-5-15(14(17)8-13)21-7-6-19-12(21)3/h4-8,10-11H,9,18H2,1-3H3,(H,20,22) |
| InChIKey | MVXJMMTWJOVCNF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |