C19H19FN4O3S — CID 56512613
N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-(4-sulfamoylphenyl)acetamide (PubChem CID 56512613) has the molecular formula C19H19FN4O3S and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-(4-sulfamoylphenyl)acetamide.
| Compound Name | N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 56512613 |
| Molecular Formula | C19H19FN4O3S |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-(4-sulfamoylphenyl)acetamide |
| SMILES | Cc1nccn1-c1ccc(CNC(=O)Cc2ccc(S(N)(=O)=O)cc2)cc1F |
| InChI | InChI=1S/C19H19FN4O3S/c1-13-22-8-9-24(13)18-7-4-15(10-17(18)20)12-23-19(25)11-14-2-5-16(6-3-14)28(21,26)27/h2-10H,11-12H2,1H3,(H,23,25)(H2,21,26,27) |
| InChIKey | HJIDFNLPQANAOK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |