C19H26FN5 — CID 111739506
N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N',3,3-trimethylpyrrolidine-1-carboximidamide (PubChem CID 111739506) has the molecular formula C19H26FN5 and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N',3,3-trimethylpyrrolidine-1-carboximidamide.
| Compound Name | N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N',3,3-trimethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111739506 |
| Molecular Formula | C19H26FN5 |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N',3,3-trimethylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccc(-n2ccnc2C)c(F)c1)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C19H26FN5/c1-14-22-8-10-25(14)17-6-5-15(11-16(17)20)12-23-18(21-4)24-9-7-19(2,3)13-24/h5-6,8,10-11H,7,9,12-13H2,1-4H3,(H,21,23) |
| InChIKey | OIPWKMOZUAIQDX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|