C20H29N5 — CID 111740066
N',3,3-trimethyl-N-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111740066) has the molecular formula C20H29N5 and a molecular weight of 339.49 g/mol. Its IUPAC name is N',3,3-trimethyl-N-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N',3,3-trimethyl-N-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111740066 |
| Molecular Formula | C20H29N5 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | N',3,3-trimethyl-N-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cccc(Cn2ccnc2C)c1)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C20H29N5/c1-16-22-9-11-24(16)14-18-7-5-6-17(12-18)13-23-19(21-4)25-10-8-20(2,3)15-25/h5-7,9,11-12H,8,10,13-15H2,1-4H3,(H,21,23) |
| InChIKey | OHNWWCUEYGPCQR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|