C22H32IN5 — CID 109441768
N'-methyl-N-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide (PubChem CID 109441768) has the molecular formula C22H32IN5 and a molecular weight of 493.44 g/mol. Its IUPAC name is N'-methyl-N-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109441768 |
| Molecular Formula | C22H32IN5 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N'-methyl-N-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(Cn2ccnc2C)c1)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C22H31N5.HI/c1-17-24-10-11-26(17)14-19-7-5-6-18(12-19)13-25-22(23-2)27-15-20-8-3-4-9-21(20)16-27;/h5-7,10-12,20-21H,3-4,8-9,13-16H2,1-2H3,(H,23,25);1H |
| InChIKey | IEMNSMLQSCGBOP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|