C18H24N4O — CID 86992760
1-cyclopentyl-3-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]urea (PubChem CID 86992760) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-cyclopentyl-3-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]urea.
| Compound Name | 1-cyclopentyl-3-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 86992760 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-cyclopentyl-3-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]urea |
| SMILES | Cc1nccn1Cc1cccc(CNC(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C18H24N4O/c1-14-19-9-10-22(14)13-16-6-4-5-15(11-16)12-20-18(23)21-17-7-2-3-8-17/h4-6,9-11,17H,2-3,7-8,12-13H2,1H3,(H2,20,21,23) |
| InChIKey | SWGIPZCAUJTMKN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |