C27H36IN5O — CID 111620279
2-methyl-1-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111620279) has the molecular formula C27H36IN5O and a molecular weight of 573.52 g/mol. Its IUPAC name is 2-methyl-1-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111620279 |
| Molecular Formula | C27H36IN5O |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 2-methyl-1-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(Cn2ccnc2C)c1)NCC1CCCOC1c1ccc(C)cc1.I |
| InChI | InChI=1S/C27H35N5O.HI/c1-20-9-11-24(12-10-20)26-25(8-5-15-33-26)18-31-27(28-3)30-17-22-6-4-7-23(16-22)19-32-14-13-29-21(32)2;/h4,6-7,9-14,16,25-26H,5,8,15,17-19H2,1-3H3,(H2,28,30,31);1H |
| InChIKey | DBBGDBZYWKIDLZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|