C25H33IN6O — CID 111619701
2-methyl-1-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111619701) has the molecular formula C25H33IN6O and a molecular weight of 560.48 g/mol. Its IUPAC name is 2-methyl-1-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111619701 |
| Molecular Formula | C25H33IN6O |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 2-methyl-1-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(-n2ccnc2C)nc1)NCC1CCCOC1c1ccc(C)cc1.I |
| InChI | InChI=1S/C25H32N6O.HI/c1-18-6-9-21(10-7-18)24-22(5-4-14-32-24)17-30-25(26-3)29-16-20-8-11-23(28-15-20)31-13-12-27-19(31)2;/h6-13,15,22,24H,4-5,14,16-17H2,1-3H3,(H2,26,29,30);1H |
| InChIKey | MINHQAWGLHIIPM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|