C23H29N7 — CID 111218945
N'-methyl-N-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111218945) has the molecular formula C23H29N7 and a molecular weight of 403.53 g/mol. Its IUPAC name is N'-methyl-N-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111218945 |
| Molecular Formula | C23H29N7 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | N'-methyl-N-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cccc(Cn2ccnc2C)c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C23H29N7/c1-19-25-10-11-30(19)18-21-7-5-6-20(16-21)17-27-23(24-2)29-14-12-28(13-15-29)22-8-3-4-9-26-22/h3-11,16H,12-15,17-18H2,1-2H3,(H,24,27) |
| InChIKey | NCNFZHSCUJEBJH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|