C19H31IN4 — CID 109441610
N-[[3-(dimethylamino)phenyl]methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide (PubChem CID 109441610) has the molecular formula C19H31IN4 and a molecular weight of 442.39 g/mol. Its IUPAC name is N-[[3-(dimethylamino)phenyl]methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N-[[3-(dimethylamino)phenyl]methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109441610 |
| Molecular Formula | C19H31IN4 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-[[3-(dimethylamino)phenyl]methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(N(C)C)c1)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C19H30N4.HI/c1-20-19(23-13-16-8-4-5-9-17(16)14-23)21-12-15-7-6-10-18(11-15)22(2)3;/h6-7,10-11,16-17H,4-5,8-9,12-14H2,1-3H3,(H,20,21);1H |
| InChIKey | ATFIMKFXVMWFGP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|