C19H27N5OS — CID 111918537
1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine (PubChem CID 111918537) has the molecular formula C19H27N5OS and a molecular weight of 373.53 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine.
| Compound Name | 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111918537 |
| Molecular Formula | C19H27N5OS |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1coc(-c2cccs2)n1)NC1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C19H27N5OS/c1-20-19(23-14-8-9-24(12-14)16-5-2-3-6-16)21-11-15-13-25-18(22-15)17-7-4-10-26-17/h4,7,10,13-14,16H,2-3,5-6,8-9,11-12H2,1H3,(H2,20,21,23) |
| InChIKey | AUOZPCNDSNMRAK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|