C16H22N4OS — CID 111210817
N',4-dimethyl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperidine-1-carboximidamide (PubChem CID 111210817) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is N',4-dimethyl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperidine-1-carboximidamide.
| Compound Name | N',4-dimethyl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111210817 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N',4-dimethyl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1coc(-c2cccs2)n1)N1CCC(C)CC1 |
| InChI | InChI=1S/C16H22N4OS/c1-12-5-7-20(8-6-12)16(17-2)18-10-13-11-21-15(19-13)14-4-3-9-22-14/h3-4,9,11-12H,5-8,10H2,1-2H3,(H,17,18) |
| InChIKey | XTBDUYIIWJBVAC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|