C20H22FN5OS — CID 111148715
4-(2-fluorophenyl)-N'-methyl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111148715) has the molecular formula C20H22FN5OS and a molecular weight of 399.50 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N'-methyl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-fluorophenyl)-N'-methyl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111148715 |
| Molecular Formula | C20H22FN5OS |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-(2-fluorophenyl)-N'-methyl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1coc(-c2cccs2)n1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H22FN5OS/c1-22-20(23-13-15-14-27-19(24-15)18-7-4-12-28-18)26-10-8-25(9-11-26)17-6-3-2-5-16(17)21/h2-7,12,14H,8-11,13H2,1H3,(H,22,23) |
| InChIKey | IDAFOWXMXSSJOZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|