C20H23N5OS — CID 110961005
N'-methyl-4-phenyl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazine-1-carboximidamide (PubChem CID 110961005) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is N'-methyl-4-phenyl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-phenyl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110961005 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N'-methyl-4-phenyl-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1coc(-c2cccs2)n1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23N5OS/c1-21-20(22-14-16-15-26-19(23-16)18-8-5-13-27-18)25-11-9-24(10-12-25)17-6-3-2-4-7-17/h2-8,13,15H,9-12,14H2,1H3,(H,21,22) |
| InChIKey | KETXATSHOQXXFF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|