C20H28IN5O4S — CID 111591482
N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111591482) has the molecular formula C20H28IN5O4S and a molecular weight of 561.45 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111591482 |
| Molecular Formula | C20H28IN5O4S |
| Molecular Weight | 561.45 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)NC1CCS(=O)(=O)C1)NCc1coc(-c2ccc(C)cc2)n1.I |
| InChI | InChI=1S/C20H27N5O4S.HI/c1-14-3-5-15(6-4-14)19-25-17(12-29-19)11-23-20(21-2)22-9-7-18(26)24-16-8-10-30(27,28)13-16;/h3-6,12,16H,7-11,13H2,1-2H3,(H,24,26)(H2,21,22,23);1H |
| InChIKey | JBBWHMISOHEQGC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|