C14H22N4O3S2 — CID 111940439
N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(thiophen-3-ylmethyl)carbamimidoyl]amino]propanamide (PubChem CID 111940439) has the molecular formula C14H22N4O3S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(thiophen-3-ylmethyl)carbamimidoyl]amino]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(thiophen-3-ylmethyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111940439 |
| Molecular Formula | C14H22N4O3S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(thiophen-3-ylmethyl)carbamimidoyl]amino]propanamide |
| SMILES | C/N=C(/NCCC(=O)NC1CCS(=O)(=O)C1)NCc1ccsc1 |
| InChI | InChI=1S/C14H22N4O3S2/c1-15-14(17-8-11-3-6-22-9-11)16-5-2-13(19)18-12-4-7-23(20,21)10-12/h3,6,9,12H,2,4-5,7-8,10H2,1H3,(H,18,19)(H2,15,16,17) |
| InChIKey | FHLBTEQDTUBJSI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|