C12H17N5O2S2 — CID 111142197
1-(1,1-dioxothiolan-3-yl)-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine (PubChem CID 111142197) has the molecular formula C12H17N5O2S2 and a molecular weight of 327.44 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111142197 |
| Molecular Formula | C12H17N5O2S2 |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1cn2ccsc2n1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H17N5O2S2/c1-13-11(15-9-2-5-21(18,19)8-9)14-6-10-7-17-3-4-20-12(17)16-10/h3-4,7,9H,2,5-6,8H2,1H3,(H2,13,14,15) |
| InChIKey | LBDPJWAAGLAVMR-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 87.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|