C13H22N4O2S2 — CID 111835033
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 111835033) has the molecular formula C13H22N4O2S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111835033 |
| Molecular Formula | C13H22N4O2S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1csc(C(C)C)n1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22N4O2S2/c1-9(2)12-16-11(7-20-12)6-15-13(14-3)17-10-4-5-21(18,19)8-10/h7,9-10H,4-6,8H2,1-3H3,(H2,14,15,17) |
| InChIKey | NTKUMRGPMDDQQF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|