C17H24ClFN4 — CID 111818754
1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 111818754) has the molecular formula C17H24ClFN4 and a molecular weight of 338.86 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111818754 |
| Molecular Formula | C17H24ClFN4 |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCN1CCCC1C/N=C(\N)NC1CC1c1c(F)cccc1Cl |
| InChI | InChI=1S/C17H24ClFN4/c1-2-23-8-4-5-11(23)10-21-17(20)22-15-9-12(15)16-13(18)6-3-7-14(16)19/h3,6-7,11-12,15H,2,4-5,8-10H2,1H3,(H3,20,21,22) |
| InChIKey | NUTUNYUSVXMYMV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|