C17H25ClN4 — CID 111818868
1-[2-(3-chlorophenyl)cyclopropyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 111818868) has the molecular formula C17H25ClN4 and a molecular weight of 320.87 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)cyclopropyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(3-chlorophenyl)cyclopropyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111818868 |
| Molecular Formula | C17H25ClN4 |
| Molecular Weight | 320.87 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-[2-(3-chlorophenyl)cyclopropyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCN1CCCC1C/N=C(\N)NC1CC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H25ClN4/c1-2-22-8-4-7-14(22)11-20-17(19)21-16-10-15(16)12-5-3-6-13(18)9-12/h3,5-6,9,14-16H,2,4,7-8,10-11H2,1H3,(H3,19,20,21) |
| InChIKey | DVPQYAYTMPGYOX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.87 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|