C15H23ClIN3 — CID 111772039
1-[2-(3-chlorophenyl)cyclopropyl]-2-ethyl-3-propan-2-ylguanidine;hydroiodide (PubChem CID 111772039) has the molecular formula C15H23ClIN3 and a molecular weight of 407.73 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)cyclopropyl]-2-ethyl-3-propan-2-ylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)cyclopropyl]-2-ethyl-3-propan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111772039 |
| Molecular Formula | C15H23ClIN3 |
| Molecular Weight | 407.73 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 1-[2-(3-chlorophenyl)cyclopropyl]-2-ethyl-3-propan-2-ylguanidine;hydroiodide |
| SMILES | CC/N=C(\NC(C)C)NC1CC1c1cccc(Cl)c1.I |
| InChI | InChI=1S/C15H22ClN3.HI/c1-4-17-15(18-10(2)3)19-14-9-13(14)11-6-5-7-12(16)8-11;/h5-8,10,13-14H,4,9H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | OVTMUVYPVDBSSC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.73 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|