C14H21N3 — CID 47091817
1,2-diethyl-3-(2-phenylcyclopropyl)guanidine (PubChem CID 47091817) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 1,2-diethyl-3-(2-phenylcyclopropyl)guanidine.
| Compound Name | 1,2-diethyl-3-(2-phenylcyclopropyl)guanidine |
|---|---|
| PubChem CID | 47091817 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 1,2-diethyl-3-(2-phenylcyclopropyl)guanidine |
| SMILES | CC/N=C(\NCC)NC1CC1c1ccccc1 |
| InChI | InChI=1S/C14H21N3/c1-3-15-14(16-4-2)17-13-10-12(13)11-8-6-5-7-9-11/h5-9,12-13H,3-4,10H2,1-2H3,(H2,15,16,17) |
| InChIKey | LSJSLHYNLJYIMM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|