C19H30N4O2 — CID 111884785
tert-butyl N-[2-[[ethylamino-[(2-phenylcyclopropyl)amino]methylidene]amino]ethyl]carbamate (PubChem CID 111884785) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is tert-butyl N-[2-[[ethylamino-[(2-phenylcyclopropyl)amino]methylidene]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[ethylamino-[(2-phenylcyclopropyl)amino]methylidene]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111884785 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | tert-butyl N-[2-[[ethylamino-[(2-phenylcyclopropyl)amino]methylidene]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CCNC(=O)OC(C)(C)C)NC1CC1c1ccccc1 |
| InChI | InChI=1S/C19H30N4O2/c1-5-20-17(21-11-12-22-18(24)25-19(2,3)4)23-16-13-15(16)14-9-7-6-8-10-14/h6-10,15-16H,5,11-13H2,1-4H3,(H,22,24)(H2,20,21,23) |
| InChIKey | KCHIGEQIXCCUGT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|