C20H23NO2 — CID 76800958
tert-butyl N-[2-(4-phenylphenyl)cyclopropyl]carbamate (PubChem CID 76800958) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl N-[2-(4-phenylphenyl)cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-phenylphenyl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 76800958 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl N-[2-(4-phenylphenyl)cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO2/c1-20(2,3)23-19(22)21-18-13-17(18)16-11-9-15(10-12-16)14-7-5-4-6-8-14/h4-12,17-18H,13H2,1-3H3,(H,21,22) |
| InChIKey | NFMTWEFPGKEYBY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |