C14H20N2O2 — CID 86673140
tert-butyl N-[(1R,2S)-2-(4-aminophenyl)cyclopropyl]carbamate (PubChem CID 86673140) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-2-(4-aminophenyl)cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-2-(4-aminophenyl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 86673140 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | tert-butyl N-[(1R,2S)-2-(4-aminophenyl)cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H]1c1ccc(N)cc1 |
| InChI | InChI=1S/C14H20N2O2/c1-14(2,3)18-13(17)16-12-8-11(12)9-4-6-10(15)7-5-9/h4-7,11-12H,8,15H2,1-3H3,(H,16,17)/t11-,12+/m0/s1 |
| InChIKey | SUYAPBUIUDTGLR-NWDGAFQWSA-N |
| XLogP | 2.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|