C14H17F2NO2 — CID 76555314
tert-butyl N-[2-(3,4-difluorophenyl)cyclopropyl]carbamate (PubChem CID 76555314) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is tert-butyl N-[2-(3,4-difluorophenyl)cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-(3,4-difluorophenyl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 76555314 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | tert-butyl N-[2-(3,4-difluorophenyl)cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H17F2NO2/c1-14(2,3)19-13(18)17-12-7-9(12)8-4-5-10(15)11(16)6-8/h4-6,9,12H,7H2,1-3H3,(H,17,18) |
| InChIKey | XNMIHRQEPIAJLO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |