C16H24N2O4S — CID 140828389
tert-butyl N-[2-[4-amino-2-(methylsulfonylmethyl)phenyl]cyclopropyl]carbamate (PubChem CID 140828389) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is tert-butyl N-[2-[4-amino-2-(methylsulfonylmethyl)phenyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-amino-2-(methylsulfonylmethyl)phenyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 140828389 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | tert-butyl N-[2-[4-amino-2-(methylsulfonylmethyl)phenyl]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC1c1ccc(N)cc1CS(C)(=O)=O |
| InChI | InChI=1S/C16H24N2O4S/c1-16(2,3)22-15(19)18-14-8-13(14)12-6-5-11(17)7-10(12)9-23(4,20)21/h5-7,13-14H,8-9,17H2,1-4H3,(H,18,19) |
| InChIKey | SVUITZBCGOKRIW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|