C23H39N5O2 — CID 109459190
tert-butyl N-[2-[[[(1-benzyl-2-methylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]ethyl]carbamate (PubChem CID 109459190) has the molecular formula C23H39N5O2 and a molecular weight of 417.60 g/mol. Its IUPAC name is tert-butyl N-[2-[[[(1-benzyl-2-methylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[[(1-benzyl-2-methylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 109459190 |
| Molecular Formula | C23H39N5O2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | tert-butyl N-[2-[[[(1-benzyl-2-methylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CCNC(=O)OC(C)(C)C)NC1CCN(Cc2ccccc2)C(C)C1 |
| InChI | InChI=1S/C23H39N5O2/c1-6-24-21(25-13-14-26-22(29)30-23(3,4)5)27-20-12-15-28(18(2)16-20)17-19-10-8-7-9-11-19/h7-11,18,20H,6,12-17H2,1-5H3,(H,26,29)(H2,24,25,27) |
| InChIKey | NPVRMBFFLNMHMR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|