C24H39N5O — CID 109458992
2-[[[(1-benzyl-2-methylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]-N-cyclohexylacetamide (PubChem CID 109458992) has the molecular formula C24H39N5O and a molecular weight of 413.61 g/mol. Its IUPAC name is 2-[[[(1-benzyl-2-methylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]-N-cyclohexylacetamide.
| Compound Name | 2-[[[(1-benzyl-2-methylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 109458992 |
| Molecular Formula | C24H39N5O |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.32 |
| IUPAC Name | 2-[[[(1-benzyl-2-methylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]-N-cyclohexylacetamide |
| SMILES | CCN/C(=N\CC(=O)NC1CCCCC1)NC1CCN(Cc2ccccc2)C(C)C1 |
| InChI | InChI=1S/C24H39N5O/c1-3-25-24(26-17-23(30)27-21-12-8-5-9-13-21)28-22-14-15-29(19(2)16-22)18-20-10-6-4-7-11-20/h4,6-7,10-11,19,21-22H,3,5,8-9,12-18H2,1-2H3,(H,27,30)(H2,25,26,28) |
| InChIKey | OGKIRWWJVQZIAM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|