C12H17N3 — CID 110918454
1,2-dimethyl-3-(2-phenylcyclopropyl)guanidine (PubChem CID 110918454) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2-phenylcyclopropyl)guanidine.
| Compound Name | 1,2-dimethyl-3-(2-phenylcyclopropyl)guanidine |
|---|---|
| PubChem CID | 110918454 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 1,2-dimethyl-3-(2-phenylcyclopropyl)guanidine |
| SMILES | C/N=C(\NC)NC1CC1c1ccccc1 |
| InChI | InChI=1S/C12H17N3/c1-13-12(14-2)15-11-8-10(11)9-6-4-3-5-7-9/h3-7,10-11H,8H2,1-2H3,(H2,13,14,15) |
| InChIKey | IHKGTDJUHBJHMS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|