C13H17F3IN3O — CID 111464814
1,2-dimethyl-3-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine;hydroiodide (PubChem CID 111464814) has the molecular formula C13H17F3IN3O and a molecular weight of 415.20 g/mol. Its IUPAC name is 1,2-dimethyl-3-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111464814 |
| Molecular Formula | C13H17F3IN3O |
| Molecular Weight | 415.20 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 1,2-dimethyl-3-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NC)NC1CC1c1ccccc1OC(F)(F)F.I |
| InChI | InChI=1S/C13H16F3N3O.HI/c1-17-12(18-2)19-10-7-9(10)8-5-3-4-6-11(8)20-13(14,15)16;/h3-6,9-10H,7H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | MRSKMFYFTRTIDX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|