C22H26F3N3O3 — CID 111773294
2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine (PubChem CID 111773294) has the molecular formula C22H26F3N3O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine |
|---|---|
| PubChem CID | 111773294 |
| Molecular Formula | C22H26F3N3O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NC1CC1c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C22H26F3N3O3/c1-4-26-21(27-13-14-9-10-19(29-2)20(11-14)30-3)28-17-12-16(17)15-7-5-6-8-18(15)31-22(23,24)25/h5-11,16-17H,4,12-13H2,1-3H3,(H2,26,27,28) |
| InChIKey | CSOODQBHUBAZOB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|