C21H24F3N3O3 — CID 111773314
1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine (PubChem CID 111773314) has the molecular formula C21H24F3N3O3 and a molecular weight of 423.44 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine |
|---|---|
| PubChem CID | 111773314 |
| Molecular Formula | C21H24F3N3O3 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(OC)c(OC)c1)NC1CC1c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C21H24F3N3O3/c1-25-20(26-12-13-8-9-18(28-2)19(10-13)29-3)27-16-11-15(16)14-6-4-5-7-17(14)30-21(22,23)24/h4-10,15-16H,11-12H2,1-3H3,(H2,25,26,27) |
| InChIKey | XJYDGSLIDTZNAS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|