C17H25N3O3 — CID 111961773
methyl 5-[[[ethylamino-[(2-methylcyclopropyl)amino]methylidene]amino]methyl]-2-methoxybenzoate (PubChem CID 111961773) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is methyl 5-[[[ethylamino-[(2-methylcyclopropyl)amino]methylidene]amino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[[ethylamino-[(2-methylcyclopropyl)amino]methylidene]amino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 111961773 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | methyl 5-[[[ethylamino-[(2-methylcyclopropyl)amino]methylidene]amino]methyl]-2-methoxybenzoate |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(C(=O)OC)c1)NC1CC1C |
| InChI | InChI=1S/C17H25N3O3/c1-5-18-17(20-14-8-11(14)2)19-10-12-6-7-15(22-3)13(9-12)16(21)23-4/h6-7,9,11,14H,5,8,10H2,1-4H3,(H2,18,19,20) |
| InChIKey | HMOWYIDHNHLELZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|