C19H29N3O3S — CID 111530379
methyl 5-[[[ethylamino-[(3-methylsulfanylcyclopentyl)amino]methylidene]amino]methyl]-2-methoxybenzoate (PubChem CID 111530379) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is methyl 5-[[[ethylamino-[(3-methylsulfanylcyclopentyl)amino]methylidene]amino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[[ethylamino-[(3-methylsulfanylcyclopentyl)amino]methylidene]amino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 111530379 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | methyl 5-[[[ethylamino-[(3-methylsulfanylcyclopentyl)amino]methylidene]amino]methyl]-2-methoxybenzoate |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(C(=O)OC)c1)NC1CCC(SC)C1 |
| InChI | InChI=1S/C19H29N3O3S/c1-5-20-19(22-14-7-8-15(11-14)26-4)21-12-13-6-9-17(24-2)16(10-13)18(23)25-3/h6,9-10,14-15H,5,7-8,11-12H2,1-4H3,(H2,20,21,22) |
| InChIKey | ZOKQTLLJXIMIFL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|