C19H32IN3O3S — CID 111529862
1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111529862) has the molecular formula C19H32IN3O3S and a molecular weight of 509.45 g/mol. Its IUPAC name is 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111529862 |
| Molecular Formula | C19H32IN3O3S |
| Molecular Weight | 509.45 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | 1-ethyl-3-(3-methylsulfanylcyclopentyl)-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)cc1OC)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C19H31N3O3S.HI/c1-6-20-19(22-14-7-8-15(10-14)26-5)21-12-13-9-17(24-3)18(25-4)11-16(13)23-2;/h9,11,14-15H,6-8,10,12H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | GIKKPFLGEGAJPD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|