C18H29N3O3 — CID 111130402
methyl 5-[[[ethylamino-(pentylamino)methylidene]amino]methyl]-2-methoxybenzoate (PubChem CID 111130402) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is methyl 5-[[[ethylamino-(pentylamino)methylidene]amino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[[ethylamino-(pentylamino)methylidene]amino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 111130402 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | methyl 5-[[[ethylamino-(pentylamino)methylidene]amino]methyl]-2-methoxybenzoate |
| SMILES | CCCCCN/C(=N/Cc1ccc(OC)c(C(=O)OC)c1)NCC |
| InChI | InChI=1S/C18H29N3O3/c1-5-7-8-11-20-18(19-6-2)21-13-14-9-10-16(23-3)15(12-14)17(22)24-4/h9-10,12H,5-8,11,13H2,1-4H3,(H2,19,20,21) |
| InChIKey | KECNCSFWAWEVIS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|