C19H31IN4O4 — CID 111383583
methyl 5-[[[[[2-(tert-butylamino)-2-oxoethyl]amino]-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide (PubChem CID 111383583) has the molecular formula C19H31IN4O4 and a molecular weight of 506.39 g/mol. Its IUPAC name is methyl 5-[[[[[2-(tert-butylamino)-2-oxoethyl]amino]-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide.
| Compound Name | methyl 5-[[[[[2-(tert-butylamino)-2-oxoethyl]amino]-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide |
|---|---|
| PubChem CID | 111383583 |
| Molecular Formula | C19H31IN4O4 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | methyl 5-[[[[[2-(tert-butylamino)-2-oxoethyl]amino]-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(C(=O)OC)c1)NCC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C19H30N4O4.HI/c1-7-20-18(22-12-16(24)23-19(2,3)4)21-11-13-8-9-15(26-5)14(10-13)17(25)27-6;/h8-10H,7,11-12H2,1-6H3,(H,23,24)(H2,20,21,22);1H |
| InChIKey | JHRRWQMREQMUTG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|