C19H21F2N3 — CID 111877779
1-ethyl-3-[2-(2-fluorophenyl)cyclopropyl]-2-[(3-fluorophenyl)methyl]guanidine (PubChem CID 111877779) has the molecular formula C19H21F2N3 and a molecular weight of 329.39 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-fluorophenyl)cyclopropyl]-2-[(3-fluorophenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-fluorophenyl)cyclopropyl]-2-[(3-fluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111877779 |
| Molecular Formula | C19H21F2N3 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-ethyl-3-[2-(2-fluorophenyl)cyclopropyl]-2-[(3-fluorophenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(F)c1)NC1CC1c1ccccc1F |
| InChI | InChI=1S/C19H21F2N3/c1-2-22-19(23-12-13-6-5-7-14(20)10-13)24-18-11-16(18)15-8-3-4-9-17(15)21/h3-10,16,18H,2,11-12H2,1H3,(H2,22,23,24) |
| InChIKey | SIABKRBZAMLGSI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|