C15H19F4N3 — CID 109474139
1-ethyl-3-[2-(2-fluorophenyl)cyclopropyl]-2-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109474139) has the molecular formula C15H19F4N3 and a molecular weight of 317.33 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-fluorophenyl)cyclopropyl]-2-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(2-fluorophenyl)cyclopropyl]-2-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109474139 |
| Molecular Formula | C15H19F4N3 |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1-ethyl-3-[2-(2-fluorophenyl)cyclopropyl]-2-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCC(F)(F)F)NC1CC1c1ccccc1F |
| InChI | InChI=1S/C15H19F4N3/c1-2-20-14(21-8-7-15(17,18)19)22-13-9-11(13)10-5-3-4-6-12(10)16/h3-6,11,13H,2,7-9H2,1H3,(H2,20,21,22) |
| InChIKey | OXJZSXPWHCEEPC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|