C18H26F3IN4O2 — CID 111819277
2-(3-morpholin-4-ylpropyl)-1-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine;hydroiodide (PubChem CID 111819277) has the molecular formula C18H26F3IN4O2 and a molecular weight of 514.33 g/mol. Its IUPAC name is 2-(3-morpholin-4-ylpropyl)-1-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine;hydroiodide.
| Compound Name | 2-(3-morpholin-4-ylpropyl)-1-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111819277 |
| Molecular Formula | C18H26F3IN4O2 |
| Molecular Weight | 514.33 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 2-(3-morpholin-4-ylpropyl)-1-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCCN1CCOCC1)NC1CC1c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C18H25F3N4O2.HI/c19-18(20,21)27-16-5-2-1-4-13(16)14-12-15(14)24-17(22)23-6-3-7-25-8-10-26-11-9-25;/h1-2,4-5,14-15H,3,6-12H2,(H3,22,23,24);1H |
| InChIKey | JDTQFXKHSHPOPB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|