C14H23IN4 — CID 110912442
2-[(1-ethylpyrrolidin-2-yl)methyl]-1-phenylguanidine;hydroiodide (PubChem CID 110912442) has the molecular formula C14H23IN4 and a molecular weight of 374.27 g/mol. Its IUPAC name is 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110912442 |
| Molecular Formula | C14H23IN4 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-phenylguanidine;hydroiodide |
| SMILES | CCN1CCCC1C/N=C(\N)Nc1ccccc1.I |
| InChI | InChI=1S/C14H22N4.HI/c1-2-18-10-6-9-13(18)11-16-14(15)17-12-7-4-3-5-8-12;/h3-5,7-8,13H,2,6,9-11H2,1H3,(H3,15,16,17);1H |
| InChIKey | DXACKJXRICXGEG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|