C16H27N5O2S — CID 111043928
1-[2-(benzenesulfonamido)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 111043928) has the molecular formula C16H27N5O2S and a molecular weight of 353.49 g/mol. Its IUPAC name is 1-[2-(benzenesulfonamido)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(benzenesulfonamido)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111043928 |
| Molecular Formula | C16H27N5O2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 1-[2-(benzenesulfonamido)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCN1CCCC1C/N=C(\N)NCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H27N5O2S/c1-2-21-12-6-7-14(21)13-19-16(17)18-10-11-20-24(22,23)15-8-4-3-5-9-15/h3-5,8-9,14,20H,2,6-7,10-13H2,1H3,(H3,17,18,19) |
| InChIKey | HBOVLLZIUVBQLZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|