C22H39IN6 — CID 111059152
1-[3-(4-benzylpiperazin-1-yl)propyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111059152) has the molecular formula C22H39IN6 and a molecular weight of 514.50 g/mol. Its IUPAC name is 1-[3-(4-benzylpiperazin-1-yl)propyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(4-benzylpiperazin-1-yl)propyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111059152 |
| Molecular Formula | C22H39IN6 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 1-[3-(4-benzylpiperazin-1-yl)propyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN1CCCC1C/N=C(\N)NCCCN1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C22H38N6.HI/c1-2-28-13-6-10-21(28)18-25-22(23)24-11-7-12-26-14-16-27(17-15-26)19-20-8-4-3-5-9-20;/h3-5,8-9,21H,2,6-7,10-19H2,1H3,(H3,23,24,25);1H |
| InChIKey | YPGMFZAHPWZXOL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 60.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|