C21H35N5O — CID 111078017
2-[(1-benzylpiperidin-2-yl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111078017) has the molecular formula C21H35N5O and a molecular weight of 373.55 g/mol. Its IUPAC name is 2-[(1-benzylpiperidin-2-yl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[(1-benzylpiperidin-2-yl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111078017 |
| Molecular Formula | C21H35N5O |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | 2-[(1-benzylpiperidin-2-yl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | N/C(=N\CC1CCCCN1Cc1ccccc1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C21H35N5O/c22-21(23-10-6-11-25-13-15-27-16-14-25)24-17-20-9-4-5-12-26(20)18-19-7-2-1-3-8-19/h1-3,7-8,20H,4-6,9-18H2,(H3,22,23,24) |
| InChIKey | SBLYYCRJISZDKC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|