C18H37N5 — CID 111057554
1-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 111057554) has the molecular formula C18H37N5 and a molecular weight of 323.53 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 1-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111057554 |
| Molecular Formula | C18H37N5 |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.30 |
| IUPAC Name | 1-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCN1CCCC1C/N=C(\N)NCCCN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C18H37N5/c1-4-23-10-5-7-17(23)12-21-18(19)20-8-6-9-22-13-15(2)11-16(3)14-22/h15-17H,4-14H2,1-3H3,(H3,19,20,21) |
| InChIKey | IRMJXFVAMRZJHU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|