C17H30IN5O2S — CID 111043801
2-[(1-ethylpyrrolidin-2-yl)methyl]-1-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 111043801) has the molecular formula C17H30IN5O2S and a molecular weight of 495.43 g/mol. Its IUPAC name is 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111043801 |
| Molecular Formula | C17H30IN5O2S |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | CCN1CCCC1C/N=C(\N)NCCNS(=O)(=O)c1ccc(C)cc1.I |
| InChI | InChI=1S/C17H29N5O2S.HI/c1-3-22-12-4-5-15(22)13-20-17(18)19-10-11-21-25(23,24)16-8-6-14(2)7-9-16;/h6-9,15,21H,3-5,10-13H2,1-2H3,(H3,18,19,20);1H |
| InChIKey | YWVTVLRQZFQLHQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|