C20H27ClFN3O — CID 119160786
N-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-N'-ethyl-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide (PubChem CID 119160786) has the molecular formula C20H27ClFN3O and a molecular weight of 379.91 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-N'-ethyl-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-N'-ethyl-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide |
|---|---|
| PubChem CID | 119160786 |
| Molecular Formula | C20H27ClFN3O |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-N'-ethyl-8-oxa-2-azaspiro[4.5]decane-2-carboximidamide |
| SMILES | CC/N=C(/NC1CC1c1c(F)cccc1Cl)N1CCC2(CCOCC2)C1 |
| InChI | InChI=1S/C20H27ClFN3O/c1-2-23-19(25-9-6-20(13-25)7-10-26-11-8-20)24-17-12-14(17)18-15(21)4-3-5-16(18)22/h3-5,14,17H,2,6-13H2,1H3,(H,23,24) |
| InChIKey | KRLURKKAAVVYQI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|