C16H23N3 — CID 110956792
N'-ethyl-N-(2-phenylcyclopropyl)pyrrolidine-1-carboximidamide (PubChem CID 110956792) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is N'-ethyl-N-(2-phenylcyclopropyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-ethyl-N-(2-phenylcyclopropyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110956792 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N'-ethyl-N-(2-phenylcyclopropyl)pyrrolidine-1-carboximidamide |
| SMILES | CC/N=C(/NC1CC1c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C16H23N3/c1-2-17-16(19-10-6-7-11-19)18-15-12-14(15)13-8-4-3-5-9-13/h3-5,8-9,14-15H,2,6-7,10-12H2,1H3,(H,17,18) |
| InChIKey | RZOBNWCSGZZEDC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|