C20H26BrIN6 — CID 111207651
N-[2-(4-bromophenyl)cyclopropyl]-N'-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111207651) has the molecular formula C20H26BrIN6 and a molecular weight of 557.28 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)cyclopropyl]-N'-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(4-bromophenyl)cyclopropyl]-N'-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111207651 |
| Molecular Formula | C20H26BrIN6 |
| Molecular Weight | 557.28 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | N-[2-(4-bromophenyl)cyclopropyl]-N'-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CC/N=C(/NC1CC1c1ccc(Br)cc1)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C20H25BrN6.HI/c1-2-22-20(25-18-14-17(18)15-4-6-16(21)7-5-15)27-12-10-26(11-13-27)19-23-8-3-9-24-19;/h3-9,17-18H,2,10-14H2,1H3,(H,22,25);1H |
| InChIKey | OVBJYADBVINGAL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|